|
Dettagli:
|
| Nome del prodotto: | Cresol sale di sodio rosso | CAS: | 62625-29-0 |
|---|---|---|---|
| EINECS: | 263-654-8 | Punto di fusione: | 250 °C (dicembre)(acceso) |
| Temperatura di archiviazione.: | Deposito al RT. | Modulo: | Polvere |
| Colore: | marrone | ||
| Evidenziare: | Cresol Red sodium salt biological stain,CAS 62625-29-0 biological stain,industrial fine chemical Cresol Red |
||
CAS 62625-29-0 Cresol Red sodium salt
| Cresol Red sodium salt Basic information |
| Product Name: | Cresol Red sodium salt |
| Synonyms: | phenol,4,4’-(3h-2,1-benzoxathiol-3-ylidene)bis[2-methyl-,s,s-dioxide,monosod;2-CRESOLSULFONEPHTHALEIN SODIUM SALT;CRESOL RED SODIUM SALT;CRESOL RED, WATER SOLUBLE;LABOTEST-BB LT00159735;Cresolsodiumsalt;o-Cresol Red, sodium salt;o-Cresolsulphonephthalein sodium salt |
| CAS: | 62625-29-0 |
| MF: | C21H19NaO5S |
| MW: | 406.43 |
| EINECS: | 263-654-8 |
| Product Categories: | Sulfonephthalein;Analytical Chemistry;Indicator (pH);pH Indicators;C;Stains and Dyes;Stains&Dyes, A to |
| Mol File: | 62625-29-0.mol |
| Cresol Red sodium salt Chemical Properties |
| Melting point | 250 °C (dec.)(lit.) |
| storage temp. | Store at RT. |
| solubility | Solubility Soluble in water, ethanol |
| form | Powder |
| pka | 1.0(at 25℃) |
| color | Brown |
| PH Range | 0.2 (red) - 1.8 (yellow) and 7.2 (yellow) - 8.8 (red) |
| Water Solubility | SOLUBLE |
| λmax | 425nm |
| Major Application | Thermochromic materials, cosmetics, measurement of hydrophobicity of therapeutic drugs |
| InChI | InChI=1S/C21H18O5S.Na.H/c1-13-11-15(7-9-18(13)22)21(16-8-10-19(23)14(2)12-16)17-5-3-4-6-20(17)27(24,25)26-21;;/h3-12,22-23H,1-2H3;; |
| InChIKey | OUMMIBMDWMSXKF-UHFFFAOYSA-N |
| SMILES | O=S1(C2C=CC=CC=2C(C2C=CC(O)=C(C)C=2)(C2C=CC(O)=C(C)C=2)O1)=O.[NaH] |
| CAS DataBase Reference | 62625-29-0(CAS DataBase Reference) |
| EPA Substance Registry System | Cresol red sodium salt (62625-29-0) |
![]()
Persona di contatto: Maggie Ma
Telefono: +0086 188 7414 9531