|
Dettagli:
|
| Nome del prodotto: | Acido di Hyodeoxycholic | Cas: | 83-49-8 |
|---|---|---|---|
| EINECS: | 201-483-2 | Punto di fusione: | 200-201 °C (acceso) |
| Temp. di conservazione: | Frigorifero | Modulo: | Solido |
| Colore: | Da bianco a biancastro | ||
| Evidenziare: | Hyodeoxycholic acid biochemical reagent,CAS83-49-8 lab chemical,Hyodeoxycholic acid fine chemical |
||
| Product Name: | Hyodeoxycholic acid |
| Synonyms: | 7-deoxyhyocholicacid;alpha-hyodeoxycholicacid;3α,6α-Dihydroxy-5β-cholanoic acid;Hyodeoxycholic;3à,6à-dihydroxy-5á-cholan-24-oic acid;3a,6a-Dihydroxy-5b-Cholan-24-Oic Acid;HYODEOXYCHOLIC ACID FREE ACID;HYODEOXYCHOLIC ACID 98% |
| CAS: | 83-49-8 |
| MF: | C24H40O4 |
| MW: | 392.58 |
| EINECS: | 201-483-2 |
| Product Categories: | Inhibitors;reference standards from Chinese medicinal herbs (TCM).;standardized herbal extract;Herb extract;Intermediates & Fine Chemicals;Isotope Labelled Compounds;Metabolites & Impurities;Pharmaceuticals;Ste roids;Natural Plant Extract;chemical reagent;pharmaceutical intermediate;phytochemical |
| Mol File: | 83-49-8.mol |
| Hyodeoxycholic acid Chemical Properties |
| Melting point | 200-201 °C (lit.) |
| alpha | D20 +8° (alc) |
| Boiling point | 437.26°C (rough estimate) |
| density | 0.9985 (rough estimate) |
| refractive index | 1.4460 (estimate) |
| storage temp. | Refrigerator |
| solubility | Solubility in methanol, very faint turbidity. Slightly soluble in alcohol, ace tone, eth er and very slightly soluble in chloroform. |
| pka | 4.76±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | 5.889mg/L(25 ºC) |
| Merck | 14,4857 |
| InChIKey | DGABKXLVXPYZII-SIBKNCMHSA-N |
| SMILES | C[C@]12CC[C@@H](O)C[C@@]1([H])[C@@H](O)C[C@@]1([H])[C@]3([H])CC[C@]([H])([C@H](C)CCC(=O)O)[C@@]3(C)CC[C@]21[H] |&1:1,4,7,9,12,14,18,20,27,31,r| |
| CAS DataBase Reference | 83-49-8(CAS DataBase Reference) |
|
|
Persona di contatto: Maggie Ma
Telefono: +0086 188 7414 9531